CAS 16156-94-8 appears in our catalog under these names: Metronidazole EP Impurity F, Metronidazole Impurity F（EP）, Metronidazole Impurity 6（Metronidazole EP Impurity F）, O-Hydroxyethyl Metronidazole, >95% (HPLC), o-Hydroxyethyl metronidazole. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 250mg.
2-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]ethanol (CAS 16156-94-8) is a chemical compound with the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. IUPAC name: 2-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]ethanol. InChIKey: UGPDZGBXWBKFMT-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O4 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 2-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]ethanol |
| InChIKey | UGPDZGBXWBKFMT-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCOCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)