CAS 60174-20-1 appears in our catalog under these names: Ornidazole Impurity 40, Ornidazole Impurity 21, Ornidazole Impurity 22, Ro 11-3696. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
1-methoxy-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (CAS 60174-20-1) is a chemical compound with the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. IUPAC name: 1-methoxy-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol. InChIKey: APGBOPOUAJNSOX-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O4 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 1-methoxy-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| InChIKey | APGBOPOUAJNSOX-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CC(COC)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)