CAS 88150-45-2 is the registry number for Ethyl (2-Azidoethoxy)acetoacetate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Ethyl 4-(2-azidoethoxy)-3-oxobutanoate (CAS 88150-45-2) is a chemical compound with the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. IUPAC name: ethyl 4-(2-azidoethoxy)-3-oxobutanoate. InChIKey: KTVPZBURNBMJNW-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O4 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | ethyl 4-(2-azidoethoxy)-3-oxobutanoate |
| InChIKey | KTVPZBURNBMJNW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)COCCN=[N+]=[N-] |
Computed by PubChem (NCBI)