CAS 161596-62-9 is the registry number for (2S,4S)-(-)-Azetidine-2,4-dicarboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2S,4S)-azetidine-2,4-dicarboxylic acid (CAS 161596-62-9) is a chemical compound with the molecular formula C5H7NO4 and a molecular weight of 145.11 g/mol. IUPAC name: (2S,4S)-azetidine-2,4-dicarboxylic acid. InChIKey: JMVIGOFRIJJUAW-HRFVKAFMSA-N.
| Molecular formula | C5H7NO4 |
|---|---|
| Molecular weight | 145.11 g/mol |
| IUPAC name | (2S,4S)-azetidine-2,4-dicarboxylic acid |
| InChIKey | JMVIGOFRIJJUAW-HRFVKAFMSA-N |
| SMILES | C1[C@H](N[C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)