CAS 1616077-53-2 is the registry number for (2R)-1-Amino-3-(1,2,3,4-tetrahydroisoquinolin-2-yl)propan-2-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol (CAS 1616077-53-2) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: (2R)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol. InChIKey: BYWDGTKESWRSML-GFCCVEGCSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | (2R)-1-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol |
| InChIKey | BYWDGTKESWRSML-GFCCVEGCSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C[C@@H](CN)O |
Computed by PubChem (NCBI)