Products 1616249-44-5
CAS 1616249-44-5 is the registry number for 3-(Benzyloxy)-2,4,5-trimethylpyridine 1-Oxide, >97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2,4,5-trimethyl-1-oxido-3-phenylmethoxypyridin-1-ium (CAS 1616249-44-5) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: 2,4,5-trimethyl-1-oxido-3-phenylmethoxypyridin-1-ium. InChIKey: GWIZHBJARBZOCL-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2,4,5-trimethyl-1-oxido-3-phenylmethoxypyridin-1-ium |
| InChIKey | GWIZHBJARBZOCL-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C(=C1C)OCC2=CC=CC=C2)C)[O-] |
Computed by PubChem (NCBI)