CAS 1616400-50-0 appears in our catalog under these names: ZEN-2759, 98%, ZEN-2759/ 99.36% (existing batch purity), ZEN–2759, ZEN-2759 99%, 1-Benzyl-5-(3,5-dimethylisoxazol-4-yl)pyridin-2(1H)-one. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 100mg, 10mg, 25mg, 50mg, 500mg, 200mg.
1-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-one (CAS 1616400-50-0) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 1-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-one. InChIKey: CIJOVPIWGFQZFF-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 1-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-one |
| InChIKey | CIJOVPIWGFQZFF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CN(C(=O)C=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)