CAS 1616773-02-4 is the registry number for 2-Thiophenecarboxylic acid, 2-[1-(4-carboxy-2-hydroxyphenyl)ethylidene]hydrazide. Offered by: Chemat. Available pack sizes: 1g.
3-hydroxy-4-[(E)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]benzoic acid (CAS 1616773-02-4) is a chemical compound with the molecular formula C14H12N2O4S and a molecular weight of 304.32 g/mol. IUPAC name: 3-hydroxy-4-[(E)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]benzoic acid. InChIKey: LVRDTOVUDQAXSA-OVCLIPMQSA-N.
| Molecular formula | C14H12N2O4S |
|---|---|
| Molecular weight | 304.32 g/mol |
| IUPAC name | 3-hydroxy-4-[(E)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]benzoic acid |
| InChIKey | LVRDTOVUDQAXSA-OVCLIPMQSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC=CS1)/C2=C(C=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)