CAS 6784-25-4 is the registry number for Diformyldapsone. Offered by: TRC. Available pack sizes: 100mg.
N-[4-(4-formamidophenyl)sulfonylphenyl]formamide (CAS 6784-25-4) is a chemical compound with the molecular formula C14H12N2O4S and a molecular weight of 304.32 g/mol. IUPAC name: N-[4-(4-formamidophenyl)sulfonylphenyl]formamide. InChIKey: NOWADDNUCMOPLH-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4S |
|---|---|
| Molecular weight | 304.32 g/mol |
| IUPAC name | N-[4-(4-formamidophenyl)sulfonylphenyl]formamide |
| InChIKey | NOWADDNUCMOPLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC=O)S(=O)(=O)C2=CC=C(C=C2)NC=O |
Computed by PubChem (NCBI)