CAS 519056-50-9 is the registry number for 5-Nitro-1-(phenylsulfonyl)indoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)-5-nitro-2,3-dihydroindole (CAS 519056-50-9) is a chemical compound with the molecular formula C14H12N2O4S and a molecular weight of 304.32 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-nitro-2,3-dihydroindole. InChIKey: UIFNZZAMKWBTFM-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4S |
|---|---|
| Molecular weight | 304.32 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-nitro-2,3-dihydroindole |
| InChIKey | UIFNZZAMKWBTFM-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)[N+](=O)[O-])S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)