CAS 1616891-31-6 is the registry number for 1-(Methylsulfonyl)-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole (CAS 1616891-31-6) is a chemical compound with the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. IUPAC name: 1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole. InChIKey: NHZQJIFLKPXAQO-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole |
| InChIKey | NHZQJIFLKPXAQO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1C2=C(CNC2)C=N1 |
Computed by PubChem (NCBI)