CAS 69467-12-5 appears in our catalog under these names: 3-Methanesulfonyl-5,6-dimethyl-1,2,4-triazine, 95%, 5,6-Dimethyl-3-(methylsulfonyl)-1,2,4-triazine, 98%, 5,6-Dimethyl-3-(methylsulfonyl)-1,2,4-triazine 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 50mg.
5,6-dimethyl-3-methylsulfonyl-1,2,4-triazine (CAS 69467-12-5) is a chemical compound with the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. IUPAC name: 5,6-dimethyl-3-methylsulfonyl-1,2,4-triazine. InChIKey: GURLJUOETMUFML-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 5,6-dimethyl-3-methylsulfonyl-1,2,4-triazine |
| InChIKey | GURLJUOETMUFML-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NC(=N1)S(=O)(=O)C)C |
Computed by PubChem (NCBI)