CAS 1783929-43-0 is the registry number for 2-Amino-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]thiazine 5,5-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,5-dioxo-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]thiazin-2-amine (CAS 1783929-43-0) is a chemical compound with the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. IUPAC name: 5,5-dioxo-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]thiazin-2-amine. InChIKey: OGCYCEDFOLDXSR-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 5,5-dioxo-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]thiazin-2-amine |
| InChIKey | OGCYCEDFOLDXSR-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC2=CC(=NN21)N |
Computed by PubChem (NCBI)