CAS 1616967-26-0 appears in our catalog under these names: Formoterol EP Impurity E, Formoterol EP Impurity E (Mixture of Diastereomers), Formoterol Impurity 5(Formoterol EP Impurity E), Formoterol fumarate dihydrate EP Impurity E, N-[2-Hydroxy-5-[1-hydroxy-2-[[2-(4-methoxy-3-methylphenyl)-1-methylethyl]amino]ethyl]phenyl]formamide. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxy-3-methylphenyl)propan-2-ylamino]ethyl]phenyl]formamide (CAS 1616967-26-0) is a chemical compound with the molecular formula C20H26N2O4 and a molecular weight of 358.4 g/mol. IUPAC name: N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxy-3-methylphenyl)propan-2-ylamino]ethyl]phenyl]formamide. InChIKey: KMTQWBVDHUNFES-UHFFFAOYSA-N.
| Molecular formula | C20H26N2O4 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxy-3-methylphenyl)propan-2-ylamino]ethyl]phenyl]formamide |
| InChIKey | KMTQWBVDHUNFES-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CC(C)NCC(C2=CC(=C(C=C2)O)NC=O)O)OC |
Computed by PubChem (NCBI)