CAS 1795135-61-3 appears in our catalog under these names: Formoterol Impurity 3 Monomer, Formoterol Impurity 3(Formoterol EP Impurity C), Formoterol EP Impurity C, Arformoterol Impurity 1, Formoterol EP Impurity C (Mixture of Diastereomers). Offered by: Hubei YoungXin, Chemat Brand, Mikromol, Biosynth. Available pack sizes: 100mg, 10mg, 200mg, 25mg, 50mg, on request, 2mg, 1mg.
N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]acetamide (CAS 1795135-61-3) is a chemical compound with the molecular formula C20H26N2O4 and a molecular weight of 358.4 g/mol. IUPAC name: N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]acetamide. InChIKey: NRUIKCFITCCGOF-UHFFFAOYSA-N.
| Molecular formula | C20H26N2O4 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]acetamide |
| InChIKey | NRUIKCFITCCGOF-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)OC)NCC(C2=CC(=C(C=C2)O)NC(=O)C)O |
Computed by PubChem (NCBI)