CAS 207801-27-2 appears in our catalog under these names: Yohimbic acid hydrate, Yohimbic acid (hydrate), 99.96%, 99.96%, Yohimbic acid (hydrate), 99.96%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 10 mg.
(1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid;hydrate (CAS 207801-27-2) is a chemical compound with the molecular formula C20H26N2O4 and a molecular weight of 358.4 g/mol. IUPAC name: (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid;hydrate. InChIKey: UXXCUDYYOMDFPX-GPRFVYSASA-N.
| Molecular formula | C20H26N2O4 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid;hydrate |
| InChIKey | UXXCUDYYOMDFPX-GPRFVYSASA-N |
| SMILES | C1C[C@@H]([C@@H]([C@@H]2[C@@H]1CN3CCC4=C([C@@H]3C2)NC5=CC=CC=C45)C(=O)O)O.O |
Computed by PubChem (NCBI)