Products 161814-86-4
CAS 161814-86-4 is the registry number for (R)-Isochromane-1-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 1g.
(1R)-3,4-dihydro-1H-isochromene-1-carboxylic acid (CAS 161814-86-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (1R)-3,4-dihydro-1H-isochromene-1-carboxylic acid. InChIKey: ZHCPCHSZBGPHCK-SECBINFHSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (1R)-3,4-dihydro-1H-isochromene-1-carboxylic acid |
| InChIKey | ZHCPCHSZBGPHCK-SECBINFHSA-N |
| SMILES | C1CO[C@H](C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-Isochroman-1-carboxylic acid