CAS 161886-61-9 appears in our catalog under these names: (S)-2-Hydroxy-4-isobutoxy-N,N,N-trimethyl-4-oxobutan-1-aminium chloride, 97%, (R)-Carnitine Chloride Isobutylester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
[(2S)-2-hydroxy-4-(2-methylpropoxy)-4-oxobutyl]-trimethylazanium chloride (CAS 161886-61-9) is a chemical compound with the molecular formula C11H24ClNO3 and a molecular weight of 253.76 g/mol. IUPAC name: [(2S)-2-hydroxy-4-(2-methylpropoxy)-4-oxobutyl]-trimethylazanium chloride. InChIKey: KIMBCAKLXFMXLT-PPHPATTJSA-M.
| Molecular formula | C11H24ClNO3 |
|---|---|
| Molecular weight | 253.76 g/mol |
| IUPAC name | [(2S)-2-hydroxy-4-(2-methylpropoxy)-4-oxobutyl]-trimethylazanium chloride |
| InChIKey | KIMBCAKLXFMXLT-PPHPATTJSA-M |
| SMILES | CC(C)COC(=O)C[C@@H](C[N+](C)(C)C)O.[Cl-] |
Computed by PubChem (NCBI)