CAS 51537-21-4 appears in our catalog under these names: H–Ser(tBu)–OtBu·HCl, H-L-Ser(tBu)-OtBu*HCl, O-tert-Butyl-L-serine tert-Butyl Ester Hydrochloride, >98.0%(T), H-Ser(tBu)-OtBu·HCl 97%, O-Tert-Butyl-L-Serine Tert-Butyl Ester Hydrochloride, 97%, 97%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 500g, 500 g, 25 g.
Tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride (CAS 51537-21-4) is a chemical compound with the molecular formula C11H24ClNO3 and a molecular weight of 253.76 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride. InChIKey: RDWZQVGVBTYCBD-QRPNPIFTSA-N.
| Molecular formula | C11H24ClNO3 |
|---|---|
| Molecular weight | 253.76 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride |
| InChIKey | RDWZQVGVBTYCBD-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)