CAS 179559-35-4 appears in our catalog under these names: H–D–Ser(tBu)–OtBu·HCl, O-tert-Butyl-D-serine t-butyl ester hydrochloride, O-(tert-Butyl)-D-serine tert-butyl ester hydrochloride, 97%, 97%, O-tert-Butyl-D-serine t-butyl ester hydr, ochloride, 1 g, O-tert-Butyl-D-serine t-butyl ester hydr, ochloride, 2 g. Offered by: GLPBio, Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 100g, 25g, 1g, 2g, 5g, 10g, 250mg.
Tert-butyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride (CAS 179559-35-4) is a chemical compound with the molecular formula C11H24ClNO3 and a molecular weight of 253.76 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride. InChIKey: RDWZQVGVBTYCBD-DDWIOCJRSA-N.
| Molecular formula | C11H24ClNO3 |
|---|---|
| Molecular weight | 253.76 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride |
| InChIKey | RDWZQVGVBTYCBD-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)