CAS 161887-04-3 is the registry number for 6-(3-Aminophenyl)-2-hydroxypyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-(3-aminophenyl)-1H-pyridin-2-one (CAS 161887-04-3) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 6-(3-aminophenyl)-1H-pyridin-2-one. InChIKey: UAVKFUCNJPJKMI-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 6-(3-aminophenyl)-1H-pyridin-2-one |
| InChIKey | UAVKFUCNJPJKMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=CC(=O)N2 |
Computed by PubChem (NCBI)