CAS 161961-43-9 is the registry number for cis-1,2,3,6-Tetrahydrophthalimide-3-hydroxy. Offered by: Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10mg, 250mg.
(3aS,4R,7aS)-4-hydroxy-3a,4,7,7a-tetrahydroisoindole-1,3-dione (CAS 161961-43-9) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: (3aS,4R,7aS)-4-hydroxy-3a,4,7,7a-tetrahydroisoindole-1,3-dione. InChIKey: MLJWDNXRMUBJJU-JKUQZMGJSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | (3aS,4R,7aS)-4-hydroxy-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| InChIKey | MLJWDNXRMUBJJU-JKUQZMGJSA-N |
| SMILES | C1C=C[C@H]([C@@H]2[C@H]1C(=O)NC2=O)O |
Computed by PubChem (NCBI)