CAS 161988-89-2 appears in our catalog under these names: 1-Bromo-4-ethyl-2-nitrobenzene 95%, 1-Bromo-4-ethyl-2-nitrobenzene, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-4-ethyl-2-nitrobenzene (CAS 161988-89-2) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-bromo-4-ethyl-2-nitrobenzene. InChIKey: MXBMKNNPFIPIBM-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-bromo-4-ethyl-2-nitrobenzene |
| InChIKey | MXBMKNNPFIPIBM-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)