Products 1620055-10-8
CAS 1620055-10-8 is the registry number for (S)-Avadomide-d1. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(3S)-3-(5-amino-2-methyl-4-oxoquinazolin-3-yl)-3-deuteriopiperidine-2,6-dione (CAS 1620055-10-8) is a chemical compound with the molecular formula C14H14N4O3 and a molecular weight of 287.29 g/mol. IUPAC name: (3S)-3-(5-amino-2-methyl-4-oxoquinazolin-3-yl)-3-deuteriopiperidine-2,6-dione. InChIKey: RSNPAKAFCAAMBH-FBNINOPRSA-N.
| Molecular formula | C14H14N4O3 |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | (3S)-3-(5-amino-2-methyl-4-oxoquinazolin-3-yl)-3-deuteriopiperidine-2,6-dione |
| InChIKey | RSNPAKAFCAAMBH-FBNINOPRSA-N |
| SMILES | [2H][C@@]1(CCC(=O)NC1=O)N2C(=NC3=CC=CC(=C3C2=O)N)C |
Computed by PubChem (NCBI)