CAS 1620473-17-7 appears in our catalog under these names: Trimethyl((4-methyl-3-nitrophenyl)ethynyl)silane, 95%, Trimethyl((4-methyl-3-nitrophenyl)ethynyl)silane, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
Trimethyl-[2-(4-methyl-3-nitrophenyl)ethynyl]silane (CAS 1620473-17-7) is a chemical compound with the molecular formula C12H15NO2Si and a molecular weight of 233.34 g/mol. IUPAC name: trimethyl-[2-(4-methyl-3-nitrophenyl)ethynyl]silane. InChIKey: WFVAXJGPWUHVSD-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2Si |
|---|---|
| Molecular weight | 233.34 g/mol |
| IUPAC name | trimethyl-[2-(4-methyl-3-nitrophenyl)ethynyl]silane |
| InChIKey | WFVAXJGPWUHVSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C#C[Si](C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)