CAS 18042-62-1 is the registry number for 2-((Trimethylsilyl)methyl)isoindoline-1,3-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(trimethylsilylmethyl)isoindole-1,3-dione (CAS 18042-62-1) is a chemical compound with the molecular formula C12H15NO2Si and a molecular weight of 233.34 g/mol. IUPAC name: 2-(trimethylsilylmethyl)isoindole-1,3-dione. InChIKey: FDUSEQGNRUIRAH-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2Si |
|---|---|
| Molecular weight | 233.34 g/mol |
| IUPAC name | 2-(trimethylsilylmethyl)isoindole-1,3-dione |
| InChIKey | FDUSEQGNRUIRAH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)