Products 219623-03-7

CAS 219623-03-7 is the registry number for Methyl 3-(2-(trimethylsilyl)ethynyl)pyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(2-trimethylsilylethynyl)pyridine-2-carboxylate (CAS 219623-03-7) is a chemical compound with the molecular formula C12H15NO2Si and a molecular weight of 233.34 g/mol. IUPAC name: methyl 3-(2-trimethylsilylethynyl)pyridine-2-carboxylate. InChIKey: IZJVWNMPTBSJLO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO2Si
Molecular weight233.34 g/mol
IUPAC namemethyl 3-(2-trimethylsilylethynyl)pyridine-2-carboxylate
InChIKeyIZJVWNMPTBSJLO-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC=N1)C#C[Si](C)(C)C

Computed by PubChem (NCBI)