Products 1620569-20-1

CAS 1620569-20-1 is the registry number for 2-(2-(Propan-2-ylidene)hydrazinyl)isonicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-propan-2-ylidenehydrazinyl)pyridine-4-carboxylic acid (CAS 1620569-20-1) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: 2-(2-propan-2-ylidenehydrazinyl)pyridine-4-carboxylic acid. InChIKey: LFMMLZUHQYAYHI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11N3O2
Molecular weight193.20 g/mol
IUPAC name2-(2-propan-2-ylidenehydrazinyl)pyridine-4-carboxylic acid
InChIKeyLFMMLZUHQYAYHI-UHFFFAOYSA-N
SMILESCC(=NNC1=NC=CC(=C1)C(=O)O)C

Computed by PubChem (NCBI)