CAS 952959-52-3 is the registry number for 4-(2-Aminoethyl)-5-(2-furyl)-1,2-dihydro-3h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-(2-aminoethyl)-5-(furan-2-yl)-1,2-dihydropyrazol-3-one (CAS 952959-52-3) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: 4-(2-aminoethyl)-5-(furan-2-yl)-1,2-dihydropyrazol-3-one. InChIKey: HTBBBMYUXHGUSH-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 4-(2-aminoethyl)-5-(furan-2-yl)-1,2-dihydropyrazol-3-one |
| InChIKey | HTBBBMYUXHGUSH-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C(C(=O)NN2)CCN |
Computed by PubChem (NCBI)