CAS 22107-30-8 appears in our catalog under these names: 2'-Hydroxyacetophenone semicarbazone, 98%, 2'-Hydroxyacetophenone semicarbazone, 98%, 98%, 2-(1-(2-Hydroxyphenyl)ethylidene)hydrazinecarboxamide, 98%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg.
[(E)-1-(2-hydroxyphenyl)ethylideneamino]urea (CAS 22107-30-8) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: [(E)-1-(2-hydroxyphenyl)ethylideneamino]urea. InChIKey: SLSXRIZAOSGASD-IZZDOVSWSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | [(E)-1-(2-hydroxyphenyl)ethylideneamino]urea |
| InChIKey | SLSXRIZAOSGASD-IZZDOVSWSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC=CC=C1O |
Computed by PubChem (NCBI)