CAS 162098-82-0 appears in our catalog under these names: 2-Amino-1,2,3,4-tetrahydronaphthalene-2-carbonitrile hydrochloride, 95%, 2-Amino-1,2,3,4-tetrahydronaphthalene-2-carbonitrile hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-3,4-dihydro-1H-naphthalene-2-carbonitrile;hydrochloride (CAS 162098-82-0) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: 2-amino-3,4-dihydro-1H-naphthalene-2-carbonitrile;hydrochloride. InChIKey: QIIDKSOFGHYBOY-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | 2-amino-3,4-dihydro-1H-naphthalene-2-carbonitrile;hydrochloride |
| InChIKey | QIIDKSOFGHYBOY-UHFFFAOYSA-N |
| SMILES | C1CC(CC2=CC=CC=C21)(C#N)N.Cl |
Computed by PubChem (NCBI)