CAS 1621066-74-7 appears in our catalog under these names: (S)–6,6'–Dibromo–2,2',3,3'–tetrahydro–1,1'–spirobi(1H–indene)–7,7'–diol, (S)-6,6'-Dibromo-2,2',3,3'-tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol, 98% 99%ee, 98% 99%ee, (S)-6,6'-Dibromo-2,2',3,3'-tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol, 98% 99%ee. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 25mg, 500mg, 250mg, 1g.
5,5'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (CAS 1621066-74-7) is a chemical compound with the molecular formula C17H14Br2O2 and a molecular weight of 410.1 g/mol. IUPAC name: 5,5'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol. InChIKey: YTOISZRZBCJFLO-UHFFFAOYSA-N.
| Molecular formula | C17H14Br2O2 |
|---|---|
| Molecular weight | 410.1 g/mol |
| IUPAC name | 5,5'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| InChIKey | YTOISZRZBCJFLO-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C(=C(C=C3)Br)O)C4=C1C=CC(=C4O)Br |
Computed by PubChem (NCBI)