CAS 1807777-59-8 is the registry number for 6,6'–Dibromo–2,2',3,3'–tetrahydro–1,1'–spirobi(1H–indene)–7,7'–diol. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
5,5'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (CAS 1807777-59-8) is a chemical compound with the molecular formula C17H14Br2O2 and a molecular weight of 410.1 g/mol. IUPAC name: 5,5'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol. InChIKey: YTOISZRZBCJFLO-UHFFFAOYSA-N.
| Molecular formula | C17H14Br2O2 |
|---|---|
| Molecular weight | 410.1 g/mol |
| IUPAC name | 5,5'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| InChIKey | YTOISZRZBCJFLO-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C(=C(C=C3)Br)O)C4=C1C=CC(=C4O)Br |
Computed by PubChem (NCBI)