CAS 636601-27-9 appears in our catalog under these names: (S)-4,4'-Dibromo-2,2',3,3'-tetrahydro-1,1'-spirobi(indene)-7,7'-diol, 98+%, (S)–4,4'–Dibromo–1,1'–spirobiindane–7,7'–diol, (S)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol, >98.0%(GC), 4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol, 98.0%, 98.0%. Offered by: AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 100mg, 1g.
7,7'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (CAS 636601-27-9) is a chemical compound with the molecular formula C17H14Br2O2 and a molecular weight of 410.1 g/mol. IUPAC name: 7,7'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol. InChIKey: OZVMVFKUNSNXQC-UHFFFAOYSA-N.
| Molecular formula | C17H14Br2O2 |
|---|---|
| Molecular weight | 410.1 g/mol |
| IUPAC name | 7,7'-dibromo-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| InChIKey | OZVMVFKUNSNXQC-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C(C=CC(=C32)O)Br)C4=C(C=CC(=C41)Br)O |
Computed by PubChem (NCBI)