Products 1621626-06-9
CAS 1621626-06-9 is the registry number for CGA-JK3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-N-cyclohexyl-3-(3,4-dihydroxyphenyl)prop-2-enamide (CAS 1621626-06-9) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: (E)-N-cyclohexyl-3-(3,4-dihydroxyphenyl)prop-2-enamide. InChIKey: BGHITLVWBRLDRS-VQHVLOKHSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (E)-N-cyclohexyl-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| InChIKey | BGHITLVWBRLDRS-VQHVLOKHSA-N |
| SMILES | C1CCC(CC1)NC(=O)/C=C/C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)
Synonyms:
caffeic acid cyclohexylamide, orb1700883