CAS 162167-94-4 appears in our catalog under these names: tert-Butyl 3-(azidomethyl)piperidine-1-carboxylate, 95%, tert-Butyl 3-(Azidomethyl)-piperidine-1-carboxylate. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 25g, 10g, 50g, 5g, 1g, 500mg.
Tert-butyl 3-(azidomethyl)piperidine-1-carboxylate (CAS 162167-94-4) is a chemical compound with the molecular formula C11H20N4O2 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 3-(azidomethyl)piperidine-1-carboxylate. InChIKey: BAEVCCYGRQSYIU-UHFFFAOYSA-N.
| Molecular formula | C11H20N4O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 3-(azidomethyl)piperidine-1-carboxylate |
| InChIKey | BAEVCCYGRQSYIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)