Products 1956369-19-9

CAS 1956369-19-9 is the registry number for tert-Butyl (1-(tert-butyl)-1h-1,2,3-triazol-4-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-tert-butyltriazol-4-yl)carbamate (CAS 1956369-19-9) is a chemical compound with the molecular formula C11H20N4O2 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl N-(1-tert-butyltriazol-4-yl)carbamate. InChIKey: VVMKQGBCFFEMRH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20N4O2
Molecular weight240.30 g/mol
IUPAC nametert-butyl N-(1-tert-butyltriazol-4-yl)carbamate
InChIKeyVVMKQGBCFFEMRH-UHFFFAOYSA-N
SMILESCC(C)(C)N1C=C(N=N1)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)