CAS 4115-66-6 is the registry number for 4,4,10,10-Tetramethyl-1,3,7,9-tetraazaspiro[5.5]undecane-2,8-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4,4,10,10-tetramethyl-1,3,7,9-tetrazaspiro[5.5]undecane-2,8-dione (CAS 4115-66-6) is a chemical compound with the molecular formula C11H20N4O2 and a molecular weight of 240.30 g/mol. IUPAC name: 4,4,10,10-tetramethyl-1,3,7,9-tetrazaspiro[5.5]undecane-2,8-dione. InChIKey: VQACAWOJMMCZHK-UHFFFAOYSA-N.
| Molecular formula | C11H20N4O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 4,4,10,10-tetramethyl-1,3,7,9-tetrazaspiro[5.5]undecane-2,8-dione |
| InChIKey | VQACAWOJMMCZHK-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CC(NC(=O)N2)(C)C)NC(=O)N1)C |
Computed by PubChem (NCBI)