Products 1621963-71-0
CAS 1621963-71-0 appears in our catalog under these names: 7-Bromo-3-iodo-4-methyl-1H-pyrrolo[3,2-c]pyridine, 7-Bromo-3-iodo-4-methyl-1H-pyrrolo[3,2-c]pyridine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
7-bromo-3-iodo-4-methyl-1H-pyrrolo[3,2-c]pyridine (CAS 1621963-71-0) is a chemical compound with the molecular formula C8H6BrIN2 and a molecular weight of 336.95 g/mol. IUPAC name: 7-bromo-3-iodo-4-methyl-1H-pyrrolo[3,2-c]pyridine. InChIKey: UVPUCEAPPQDZRF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIN2 |
|---|---|
| Molecular weight | 336.95 g/mol |
| IUPAC name | 7-bromo-3-iodo-4-methyl-1H-pyrrolo[3,2-c]pyridine |
| InChIKey | UVPUCEAPPQDZRF-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C2=C1C(=CN2)I)Br |
Computed by PubChem (NCBI)