CAS 16220-95-4 appears in our catalog under these names: Methyl 2–Chloro–5–Methylbenzoate, Methyl 2-chloro-5-methylbenzoate 98%, Benzoic acid,2-chloro-5-methyl-,methyl ester, 98%, 98%, METHYL 2-CHLORO-5-METHYLBENZOATE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
Methyl 2-chloro-5-methylbenzoate (CAS 16220-95-4) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: methyl 2-chloro-5-methylbenzoate. InChIKey: DLULLCMISBPNTK-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | methyl 2-chloro-5-methylbenzoate |
| InChIKey | DLULLCMISBPNTK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)