CAS 1622303-52-9 is the registry number for 4–Bromo–6–methyl–7–oxo–6,7–dihydro–1H–pyrrolo(2,3–c)pyridine–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
4-bromo-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid (CAS 1622303-52-9) is a chemical compound with the molecular formula C9H7BrN2O3 and a molecular weight of 271.07 g/mol. IUPAC name: 4-bromo-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid. InChIKey: LFRWMZSZWBHKDA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O3 |
|---|---|
| Molecular weight | 271.07 g/mol |
| IUPAC name | 4-bromo-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid |
| InChIKey | LFRWMZSZWBHKDA-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)NC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)