CAS 20086-06-0 appears in our catalog under these names: Diosbulbin B, Diosbulbin B/ 98.92% (existing batch purity), Diosbulbin B, Diosbulbin B, 97%, 97%, Diosbulbin B, 99.90%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 20mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione (CAS 20086-06-0) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: 3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione. InChIKey: QEANLIISUSNNDX-UHFFFAOYSA-N.
| Molecular formula | C19H20O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione |
| InChIKey | QEANLIISUSNNDX-UHFFFAOYSA-N |
| SMILES | CC12CC(OC13CC(C4C2CC5CC4C(=O)O5)OC3=O)C6=COC=C6 |
Computed by PubChem (NCBI)