CAS 1622940-14-0 is the registry number for 1–(((4–Chlorophenoxy)carbonyl)oxy)ethyl isobutyrate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
1-(4-chlorophenoxy)carbonyloxyethyl 2-methylpropanoate (CAS 1622940-14-0) is a chemical compound with the molecular formula C13H15ClO5 and a molecular weight of 286.71 g/mol. IUPAC name: 1-(4-chlorophenoxy)carbonyloxyethyl 2-methylpropanoate. InChIKey: XSHOSCHERXEKED-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO5 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 1-(4-chlorophenoxy)carbonyloxyethyl 2-methylpropanoate |
| InChIKey | XSHOSCHERXEKED-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC(C)OC(=O)OC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)