CAS 879178-35-5 is the registry number for Methyl 2-(2-chloro-6-ethoxy-4-formylphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 2-(2-chloro-6-ethoxy-4-formylphenoxy)propanoate (CAS 879178-35-5) is a chemical compound with the molecular formula C13H15ClO5 and a molecular weight of 286.71 g/mol. IUPAC name: methyl 2-(2-chloro-6-ethoxy-4-formylphenoxy)propanoate. InChIKey: PNWBGDIJGMFKNL-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO5 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | methyl 2-(2-chloro-6-ethoxy-4-formylphenoxy)propanoate |
| InChIKey | PNWBGDIJGMFKNL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Cl)OC(C)C(=O)OC |
Computed by PubChem (NCBI)