Products 879178-35-5

CAS 879178-35-5 is the registry number for Methyl 2-(2-chloro-6-ethoxy-4-formylphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-(2-chloro-6-ethoxy-4-formylphenoxy)propanoate (CAS 879178-35-5) is a chemical compound with the molecular formula C13H15ClO5 and a molecular weight of 286.71 g/mol. IUPAC name: methyl 2-(2-chloro-6-ethoxy-4-formylphenoxy)propanoate. InChIKey: PNWBGDIJGMFKNL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClO5
Molecular weight286.71 g/mol
IUPAC namemethyl 2-(2-chloro-6-ethoxy-4-formylphenoxy)propanoate
InChIKeyPNWBGDIJGMFKNL-UHFFFAOYSA-N
SMILESCCOC1=C(C(=CC(=C1)C=O)Cl)OC(C)C(=O)OC

Computed by PubChem (NCBI)