Products 881592-98-9

CAS 881592-98-9 is the registry number for Ethyl 2-(2-chloro-4-formyl-6-methoxyphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-chloro-4-formyl-6-methoxyphenoxy)propanoate (CAS 881592-98-9) is a chemical compound with the molecular formula C13H15ClO5 and a molecular weight of 286.71 g/mol. IUPAC name: ethyl 2-(2-chloro-4-formyl-6-methoxyphenoxy)propanoate. InChIKey: QTDWCFVXLBYXIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClO5
Molecular weight286.71 g/mol
IUPAC nameethyl 2-(2-chloro-4-formyl-6-methoxyphenoxy)propanoate
InChIKeyQTDWCFVXLBYXIQ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)OC1=C(C=C(C=C1Cl)C=O)OC

Computed by PubChem (NCBI)