Products 1622947-22-1
CAS 1622947-22-1 is the registry number for Micrometam A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)-N-methylprop-2-enamide (CAS 1622947-22-1) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: (E)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)-N-methylprop-2-enamide. InChIKey: MIJVOIYIPNJYSV-NYYWCZLTSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | (E)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)-N-methylprop-2-enamide |
| InChIKey | MIJVOIYIPNJYSV-NYYWCZLTSA-N |
| SMILES | CN(CC(C1=CC=C(C=C1)O)O)C(=O)/C=C/C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)
Synonyms:
micrometam A, orb2695096