Products 1622986-23-5
CAS 1622986-23-5 appears in our catalog under these names: 4-(4-Hydroxytetrahydropyran-4-yl)phenylboronic acid, 95%, 4-(4-Hydroxytetrahydropyran-4-yl)phenylboronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 25mg, 50mg, 100mg.
[4-(4-hydroxyoxan-4-yl)phenyl]boronic acid (CAS 1622986-23-5) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: [4-(4-hydroxyoxan-4-yl)phenyl]boronic acid. InChIKey: BJVQFACZRDIKSQ-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [4-(4-hydroxyoxan-4-yl)phenyl]boronic acid |
| InChIKey | BJVQFACZRDIKSQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CCOCC2)O)(O)O |
Computed by PubChem (NCBI)