CAS 1622988-14-0 appears in our catalog under these names: cis-Benvitimod, Benvitimod Impurity 1 (cis-Benvitimod), 2-(1-Methylethyl)-5-((1Z)-2-phenylethenyl)-1,3-benzenediol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,5g, 0,25g.
5-[(Z)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol (CAS 1622988-14-0) is a chemical compound with the molecular formula C17H18O2 and a molecular weight of 254.32 g/mol. IUPAC name: 5-[(Z)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol. InChIKey: ZISJNXNHJRQYJO-HJWRWDBZSA-N.
| Molecular formula | C17H18O2 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | 5-[(Z)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol |
| InChIKey | ZISJNXNHJRQYJO-HJWRWDBZSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1O)/C=C\C2=CC=CC=C2)O |
Computed by PubChem (NCBI)