CAS 162320-01-6 appears in our catalog under these names: [1,1':4',1''-Terphenyl]-4-yl acrylate 95%, [1,1':4',1''-Terphenyl]-4-yl acrylate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(4-phenylphenyl)phenyl] prop-2-enoate (CAS 162320-01-6) is a chemical compound with the molecular formula C21H16O2 and a molecular weight of 300.3 g/mol. IUPAC name: [4-(4-phenylphenyl)phenyl] prop-2-enoate. InChIKey: SSEOIKAETDSAMF-UHFFFAOYSA-N.
| Molecular formula | C21H16O2 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | [4-(4-phenylphenyl)phenyl] prop-2-enoate |
| InChIKey | SSEOIKAETDSAMF-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)