CAS 869959-16-0 is the registry number for 2'-Methyl-[1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-formylphenyl)-3-methylphenyl]benzaldehyde (CAS 869959-16-0) is a chemical compound with the molecular formula C21H16O2 and a molecular weight of 300.3 g/mol. IUPAC name: 4-[4-(4-formylphenyl)-3-methylphenyl]benzaldehyde. InChIKey: AYQLKZPTRGFNRY-UHFFFAOYSA-N.
| Molecular formula | C21H16O2 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 4-[4-(4-formylphenyl)-3-methylphenyl]benzaldehyde |
| InChIKey | AYQLKZPTRGFNRY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=C(C=C2)C=O)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)